![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| AntiracistEducation.pdf | 2006-10-28 13:16 | 220K | |
| BlockIsyllabus.htm | 2010-07-08 10:00 | 292K | |
| BlockIsyllabus.pdf | 2006-08-15 12:47 | 166K | |
| CMModel.dot | 2005-08-09 11:29 | 32K | |
| CMModel.pdf | 2005-08-09 11:29 | 22K | |
| CMrubric.pdf | 2005-08-09 11:30 | 18K | |
| Communicating.pdf | 2006-07-19 12:55 | 530K | |
| Content Reading and ..> | 2005-11-26 11:34 | 516K | |
| Content Reading and ..> | 2005-11-26 11:34 | 891K | |
| Content Reading and ..> | 2005-11-26 11:34 | 464K | |
| DifferentiatedInstru..> | 2006-07-19 13:00 | 524K | |
| Faggot.pdf | 2006-10-28 13:18 | 58K | |
| LegalIssues.pdf | 2006-07-19 13:12 | 605K | |
| NArubric.mht | 2005-02-01 04:59 | 26K | |
| NArubric.pdf | 2006-10-26 07:36 | 19K | |
| RevisedAssignmentSum..> | 2006-09-13 12:09 | 73K | |
| SEP.pdf | 2004-09-21 13:30 | 486K | |
| SavageInequalities.pdf | 2006-11-01 14:59 | 104K | |
| Text Structure Examp..> | 2005-11-26 11:10 | 368K | |
| UpdatedBlockICalenda..> | 2006-11-15 13:56 | 159K | |
| assessmentppt.mht | 2005-09-28 07:31 | 506K | |
| assessmentppt.pdf | 2005-09-28 07:29 | 172K | |
| attendance.pdf | 2002-08-29 07:41 | 5.2K | |
| block1.html | 2012-08-07 13:46 | 5.3K | |
| calendar.htm | 2006-08-15 13:37 | 131K | |
| calendar.pdf | 2006-08-15 13:21 | 72K | |
| calendar_files/ | 2011-08-16 21:03 | - | |
| conceptmap.pdf | 2005-08-09 11:30 | 12K | |
| costsheet.htm | 2004-09-08 11:04 | 23K | |
| costsheet.mht | 2004-09-08 11:03 | 27K | |
| costsheet.pdf | 2004-09-08 11:02 | 7.4K | |
| culturalreading.pdf | 2006-08-09 11:04 | 18K | |
| difflesson.pdf | 2006-10-24 14:19 | 17K | |
| evidence.pdf | 2006-08-15 12:01 | 46K | |
| facets.pdf | 2006-10-28 13:09 | 16K | |
| firstday.htm | 2003-08-26 14:01 | 7.0K | |
| firstday.pdf | 2003-08-26 14:01 | 5.2K | |
| foundations.mht | 2006-08-28 11:18 | 1.0M | |
| foundations.pdf | 2006-08-28 11:28 | 537K | |
| interview.pdf | 2005-08-09 11:30 | 15K | |
| licensure and ed fee..> | 2002-10-09 08:53 | 6.6K | |
| longsample.pdf | 2004-09-07 14:34 | 284K | |
| nochild.mht | 2005-09-21 12:25 | 346K | |
| nochild.pdf | 2005-09-21 12:31 | 160K | |
| parent communication..> | 2006-08-08 10:37 | 16K | |
| portfoliorubric.htm | 2001-06-12 11:32 | 15K | |
| portfolio rubric.pdf | 2005-08-09 11:30 | 15K | |
| readinggroups.htm | 2006-09-14 15:05 | 17K | |
| st1short.pdf | 2004-09-21 13:30 | 399K | |
| st2.pdf | 2004-09-21 13:30 | 730K | |
| strategypres.pdf | 2006-08-08 11:10 | 17K | |
| textset.pdf | 2006-08-08 10:53 | 17K | |
| vocabgroups.htm | 2006-09-12 14:52 | 28K | |